C72H57N — CID 134194323
3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,5-dien-1-yl]-4-phenyl-N,N-bis[4-phenyl-3-(4-phenylphenyl)phenyl]aniline (PubChem CID 134194323) has the molecular formula C72H57N and a molecular weight of 936.26 g/mol. Its IUPAC name is 3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,5-dien-1-yl]-4-phenyl-N,N-bis[4-phenyl-3-(4-phenylphenyl)phenyl]aniline.
| Compound Name | 3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,5-dien-1-yl]-4-phenyl-N,N-bis[4-phenyl-3-(4-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 134194323 |
| Molecular Formula | C72H57N |
| Molecular Weight | 936.26 g/mol |
| Exact Mass | 935.45 |
| IUPAC Name | 3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,5-dien-1-yl]-4-phenyl-N,N-bis[4-phenyl-3-(4-phenylphenyl)phenyl]aniline |
| SMILES | C/C=C\C(=C/C)C1C=CC(c2cc(N(c3ccc(-c4ccccc4)c(-c4ccc(-c5ccccc5)cc4)c3)c3ccc(-c4ccccc4)c(-c4ccc(-c5ccccc5)cc4)c3)ccc2-c2ccccc2)=CC1 |
| InChI | InChI=1S/C72H57N/c1-3-20-52(4-2)55-31-37-61(38-32-55)70-49-64(43-46-67(70)58-25-14-7-15-26-58)73(65-44-47-68(59-27-16-8-17-28-59)71(50-65)62-39-33-56(34-40-62)53-21-10-5-11-22-53)66-45-48-69(60-29-18-9-19-30-60)72(51-66)63-41-35-57(36-42-63)54-23-12-6-13-24-54/h3-31,33-51,55H,32H2,1-2H3/b20-3-,52-4+ |
| InChIKey | FYNFGRMLPQYSAJ-XRZYETGYSA-N |
| XLogP | 20.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.26 |
| LogP ≤ 5 | 20.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|