C50H88N2O6 — CID 166831543
8-[(2E,4Z)-6-(8-decanoyloxyoctoxy)-4-[3-(2-methylimidazol-1-yl)propyl]hepta-2,4,6-trien-2-yl]oxyoctyl decanoate (PubChem CID 166831543) has the molecular formula C50H88N2O6 and a molecular weight of 813.26 g/mol. Its IUPAC name is 8-[(2E,4Z)-6-(8-decanoyloxyoctoxy)-4-[3-(2-methylimidazol-1-yl)propyl]hepta-2,4,6-trien-2-yl]oxyoctyl decanoate.
| Compound Name | 8-[(2E,4Z)-6-(8-decanoyloxyoctoxy)-4-[3-(2-methylimidazol-1-yl)propyl]hepta-2,4,6-trien-2-yl]oxyoctyl decanoate |
|---|---|
| PubChem CID | 166831543 |
| Molecular Formula | C50H88N2O6 |
| Molecular Weight | 813.26 g/mol |
| Exact Mass | 812.66 |
| IUPAC Name | 8-[(2E,4Z)-6-(8-decanoyloxyoctoxy)-4-[3-(2-methylimidazol-1-yl)propyl]hepta-2,4,6-trien-2-yl]oxyoctyl decanoate |
| SMILES | C=C(/C=C(\C=C(/C)OCCCCCCCCOC(=O)CCCCCCCCC)CCCn1ccnc1C)OCCCCCCCCOC(=O)CCCCCCCCC |
| InChI | InChI=1S/C50H88N2O6/c1-6-8-10-12-14-20-26-34-49(53)57-41-30-24-18-16-22-28-39-55-45(3)43-48(33-32-37-52-38-36-51-47(52)5)44-46(4)56-40-29-23-17-19-25-31-42-58-50(54)35-27-21-15-13-11-9-7-2/h36,38,43-44H,3,6-35,37,39-42H2,1-2,4-5H3/b46-44+,48-43- |
| InChIKey | DKKNYWHMPXKGPS-BJQUZELMSA-N |
| XLogP | 14.40 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.26 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|