C28H40O10Sn — CID 16683185
[dibutyl-(3,4,5-trimethoxybenzoyl)oxystannyl] 3,4,5-trimethoxybenzoate (PubChem CID 16683185) has the molecular formula C28H40O10Sn and a molecular weight of 655.33 g/mol. Its IUPAC name is [dibutyl-(3,4,5-trimethoxybenzoyl)oxystannyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [dibutyl-(3,4,5-trimethoxybenzoyl)oxystannyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 16683185 |
| Molecular Formula | C28H40O10Sn |
| Molecular Weight | 655.33 g/mol |
| Exact Mass | 656.16 |
| IUPAC Name | [dibutyl-(3,4,5-trimethoxybenzoyl)oxystannyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)c1cc(OC)c(OC)c(OC)c1)OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/2C10H12O5.2C4H9.Sn/c2*1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3;2*1-3-4-2;/h2*4-5H,1-3H3,(H,11,12);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | JFRMRNAMFYAHPG-UHFFFAOYSA-L |
| XLogP | 5.79 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |