C14H22N2O3S2 — CID 166832178
(2R)-2-(methylamino)-N-[3-(3-methylphenyl)sulfonylpropyl]-3-sulfanylpropanamide (PubChem CID 166832178) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is (2R)-2-(methylamino)-N-[3-(3-methylphenyl)sulfonylpropyl]-3-sulfanylpropanamide.
| Compound Name | (2R)-2-(methylamino)-N-[3-(3-methylphenyl)sulfonylpropyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 166832178 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (2R)-2-(methylamino)-N-[3-(3-methylphenyl)sulfonylpropyl]-3-sulfanylpropanamide |
| SMILES | CN[C@@H](CS)C(=O)NCCCS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-11-5-3-6-12(9-11)21(18,19)8-4-7-16-14(17)13(10-20)15-2/h3,5-6,9,13,15,20H,4,7-8,10H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | WPTSTCLGGHBXJM-ZDUSSCGKSA-N |
| XLogP | 0.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|