C10H14N2 — CID 166832529
3-cyclopropyl-N,N-dimethylpyridin-4-amine (PubChem CID 166832529) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-cyclopropyl-N,N-dimethylpyridin-4-amine.
| Compound Name | 3-cyclopropyl-N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 166832529 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-cyclopropyl-N,N-dimethylpyridin-4-amine |
| SMILES | CN(C)c1ccncc1C1CC1 |
| InChI | InChI=1S/C10H14N2/c1-12(2)10-5-6-11-7-9(10)8-3-4-8/h5-8H,3-4H2,1-2H3 |
| InChIKey | VNFQZCGBUJUXAL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |