C16H20ClN5O2 — CID 166834503
N-(4-chlorophenyl)-2-[[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]amino]acetamide (PubChem CID 166834503) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]amino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 166834503 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[4-(3-hydroxypropylamino)-6-methylpyrimidin-2-yl]amino]acetamide |
| SMILES | Cc1cc(NCCCO)nc(NCC(=O)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H20ClN5O2/c1-11-9-14(18-7-2-8-23)22-16(20-11)19-10-15(24)21-13-5-3-12(17)4-6-13/h3-6,9,23H,2,7-8,10H2,1H3,(H,21,24)(H2,18,19,20,22) |
| InChIKey | LBWCRPVXWUCWFQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|