C23H29ClN4O2 — CID 166834763
N-[4-[(4-chlorophenyl)methylcarbamoylamino]cyclohexyl]-2-(dimethylamino)benzamide (PubChem CID 166834763) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methylcarbamoylamino]cyclohexyl]-2-(dimethylamino)benzamide.
| Compound Name | N-[4-[(4-chlorophenyl)methylcarbamoylamino]cyclohexyl]-2-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 166834763 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methylcarbamoylamino]cyclohexyl]-2-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccccc1C(=O)NC1CCC(NC(=O)NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H29ClN4O2/c1-28(2)21-6-4-3-5-20(21)22(29)26-18-11-13-19(14-12-18)27-23(30)25-15-16-7-9-17(24)10-8-16/h3-10,18-19H,11-15H2,1-2H3,(H,26,29)(H2,25,27,30) |
| InChIKey | AQRVTZSCDWJSAH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |