C23H22FN5OS — CID 166838922
N-(3-cyano-4-fluorophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-imino-7-methyl-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 166838922) has the molecular formula C23H22FN5OS and a molecular weight of 435.53 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-imino-7-methyl-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-imino-7-methyl-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 166838922 |
| Molecular Formula | C23H22FN5OS |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-imino-7-methyl-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]/N=S1\NC(C(/C=C\C)=C/C=C)C=Cc2c1cn(C)c2C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C23H22FN5OS/c1-4-6-15(7-5-2)20-11-9-18-21(31(26)28-20)14-29(3)22(18)23(30)27-17-8-10-19(24)16(12-17)13-25/h4-12,14,20H,1H2,2-3H3,(H2,26,28)(H,27,30)/b7-5-,15-6+ |
| InChIKey | BOZQYBBKDRDYOW-FIVZRHHBSA-N |
| XLogP | 4.62 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|