C18H17F3N4OS — CID 166838971
3-cyclopropyl-1-imino-7-methyl-N-(3,4,5-trifluorophenyl)-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 166838971) has the molecular formula C18H17F3N4OS and a molecular weight of 394.42 g/mol. Its IUPAC name is 3-cyclopropyl-1-imino-7-methyl-N-(3,4,5-trifluorophenyl)-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | 3-cyclopropyl-1-imino-7-methyl-N-(3,4,5-trifluorophenyl)-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 166838971 |
| Molecular Formula | C18H17F3N4OS |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 3-cyclopropyl-1-imino-7-methyl-N-(3,4,5-trifluorophenyl)-2,3-dihydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]/N=S1\NC(C2CC2)C=Cc2c1cn(C)c2C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H17F3N4OS/c1-25-8-15-11(4-5-14(9-2-3-9)24-27(15)22)17(25)18(26)23-10-6-12(19)16(21)13(20)7-10/h4-9,14H,2-3H2,1H3,(H2,22,24)(H,23,26) |
| InChIKey | LZXXGWVVLMCSBJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|