C7H12IN — CID 166840052
(1R,5S)-2-ethyl-3-iodo-3-azabicyclo[3.1.0]hexane (PubChem CID 166840052) has the molecular formula C7H12IN and a molecular weight of 237.08 g/mol. Its IUPAC name is (1R,5S)-2-ethyl-3-iodo-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-2-ethyl-3-iodo-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 166840052 |
| Molecular Formula | C7H12IN |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | (1R,5S)-2-ethyl-3-iodo-3-azabicyclo[3.1.0]hexane |
| SMILES | CCC1[C@@H]2C[C@@H]2CN1I |
| InChI | InChI=1S/C7H12IN/c1-2-7-6-3-5(6)4-9(7)8/h5-7H,2-4H2,1H3/t5-,6-,7?/m1/s1 |
| InChIKey | YEEYRBVONKGEFT-CQMSUOBXSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|