C15H23NO2 — CID 67789671
(3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl)methanol;ethanol (PubChem CID 67789671) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl)methanol;ethanol.
| Compound Name | (3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl)methanol;ethanol |
|---|---|
| PubChem CID | 67789671 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl)methanol;ethanol |
| SMILES | CCO.OCC1C2CC2CN1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO.C2H6O/c15-9-13-12-6-11(12)8-14(13)7-10-4-2-1-3-5-10;1-2-3/h1-5,11-13,15H,6-9H2;3H,2H2,1H3 |
| InChIKey | DCQQRADFPLVMJQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |