C13H18N2 — CID 90065591
[(2S,5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl]methanamine (PubChem CID 90065591) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is [(2S,5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl]methanamine.
| Compound Name | [(2S,5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl]methanamine |
|---|---|
| PubChem CID | 90065591 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | [(2S,5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-2-yl]methanamine |
| SMILES | NC[C@@H]1C2C[C@H]2CN1Cc1ccccc1 |
| InChI | InChI=1S/C13H18N2/c14-7-13-12-6-11(12)9-15(13)8-10-4-2-1-3-5-10/h1-5,11-13H,6-9,14H2/t11-,12?,13+/m0/s1 |
| InChIKey | BYIORNOSWMDYSC-IAMFDIQRSA-N |
| XLogP | 1.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |