C15H22N3+ — CID 135018151
[(3R,3aR,6aS)-2-benzyl-5-methyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-3-yl]methanamine (PubChem CID 135018151) has the molecular formula C15H22N3+ and a molecular weight of 244.36 g/mol. Its IUPAC name is [(3R,3aR,6aS)-2-benzyl-5-methyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-3-yl]methanamine.
| Compound Name | [(3R,3aR,6aS)-2-benzyl-5-methyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-3-yl]methanamine |
|---|---|
| PubChem CID | 135018151 |
| Molecular Formula | C15H22N3+ |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | [(3R,3aR,6aS)-2-benzyl-5-methyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-3-yl]methanamine |
| SMILES | C[N+]1=C[C@@H]2[C@@H](CN(Cc3ccccc3)[C@H]2CN)C1 |
| InChI | InChI=1S/C15H22N3/c1-17-9-13-10-18(15(7-16)14(13)11-17)8-12-5-3-2-4-6-12/h2-6,11,13-15H,7-10,16H2,1H3/q+1/t13-,14-,15+/m1/s1 |
| InChIKey | SDPRXMNYKMEQRZ-KFWWJZLASA-N |
| XLogP | 0.79 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|