C27H36ClN5O4 — CID 166840251
2-(6-chloro-4-methoxy-1H-indole-2-carbonyl)-N-[2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-1-(methylamino)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166840251) has the molecular formula C27H36ClN5O4 and a molecular weight of 530.07 g/mol. Its IUPAC name is 2-(6-chloro-4-methoxy-1H-indole-2-carbonyl)-N-[2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-1-(methylamino)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 2-(6-chloro-4-methoxy-1H-indole-2-carbonyl)-N-[2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-1-(methylamino)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166840251 |
| Molecular Formula | C27H36ClN5O4 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 2-(6-chloro-4-methoxy-1H-indole-2-carbonyl)-N-[2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)-1-(methylamino)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CNC(CC1CC(C)(C)NC1=O)NC(=O)C1C2CCCC2CN1C(=O)c1cc2c(OC)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C27H36ClN5O4/c1-27(2)12-15(24(34)32-27)8-22(29-3)31-25(35)23-17-7-5-6-14(17)13-33(23)26(36)20-11-18-19(30-20)9-16(28)10-21(18)37-4/h9-11,14-15,17,22-23,29-30H,5-8,12-13H2,1-4H3,(H,31,35)(H,32,34) |
| InChIKey | XXLLPJIRISVEQN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|