C28H37N5O5 — CID 166840752
(2S)-N-[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-4-cyclohexyl-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 166840752) has the molecular formula C28H37N5O5 and a molecular weight of 523.63 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-4-cyclohexyl-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-4-cyclohexyl-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166840752 |
| Molecular Formula | C28H37N5O5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-4-cyclohexyl-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC(C4CCCCC4)C[C@H]3C(=O)N[C@@H](C[C@@H]3CCNC3=O)C(N)=O)cc12 |
| InChI | InChI=1S/C28H37N5O5/c1-38-24-9-5-8-20-19(24)14-22(31-20)28(37)33-15-18(16-6-3-2-4-7-16)13-23(33)27(36)32-21(25(29)34)12-17-10-11-30-26(17)35/h5,8-9,14,16-18,21,23,31H,2-4,6-7,10-13,15H2,1H3,(H2,29,34)(H,30,35)(H,32,36)/t17-,18?,21-,23-/m0/s1 |
| InChIKey | CFDXQUBQVWGXFH-FVECLMPASA-N |
| XLogP | 2.08 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |