C27H38N4O2 — CID 166841757
1-[(1S,4bR,6aS,8R,10aS,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-purin-9-ylethanone (PubChem CID 166841757) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-[(1S,4bR,6aS,8R,10aS,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-purin-9-ylethanone.
| Compound Name | 1-[(1S,4bR,6aS,8R,10aS,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-purin-9-ylethanone |
|---|---|
| PubChem CID | 166841757 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 1-[(1S,4bR,6aS,8R,10aS,10bS,12aS)-8-hydroxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-purin-9-ylethanone |
| SMILES | C[C@]12CC[C@@H](O)C[C@@H]1CC[C@H]1C3CCC[C@H](C(=O)Cn4cnc5cncnc54)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C27H38N4O2/c1-26-10-8-18(32)12-17(26)6-7-19-20-4-3-5-22(27(20,2)11-9-21(19)26)24(33)14-31-16-30-23-13-28-15-29-25(23)31/h13,15-22,32H,3-12,14H2,1-2H3/t17-,18+,19-,20?,21-,22+,26-,27-/m0/s1 |
| InChIKey | OOCNNOFXEQXCEM-NLERYJAYSA-N |
| XLogP | 4.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |