C27H37ClN4O — CID 166841764
1-[(1S,4bR,10aS,12aS)-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-(6-chloropurin-7-yl)ethanone (PubChem CID 166841764) has the molecular formula C27H37ClN4O and a molecular weight of 469.07 g/mol. Its IUPAC name is 1-[(1S,4bR,10aS,12aS)-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-(6-chloropurin-7-yl)ethanone.
| Compound Name | 1-[(1S,4bR,10aS,12aS)-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-(6-chloropurin-7-yl)ethanone |
|---|---|
| PubChem CID | 166841764 |
| Molecular Formula | C27H37ClN4O |
| Molecular Weight | 469.07 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1-[(1S,4bR,10aS,12aS)-10a,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-hexadecahydrochrysen-1-yl]-2-(6-chloropurin-7-yl)ethanone |
| SMILES | C[C@]12CCCCC1CC[C@@H]1C2CC[C@@]2(C)C1CCC[C@@H]2C(=O)Cn1cnc2ncnc(Cl)c21 |
| InChI | InChI=1S/C27H37ClN4O/c1-26-12-4-3-6-17(26)9-10-18-19-7-5-8-21(27(19,2)13-11-20(18)26)22(33)14-32-16-31-25-23(32)24(28)29-15-30-25/h15-21H,3-14H2,1-2H3/t17?,18-,19?,20?,21+,26-,27-/m0/s1 |
| InChIKey | ZLINQMCJSRKETN-HKEYDZMASA-N |
| XLogP | 6.49 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.07 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |