C7H8INS — CID 166842058
2-iodo-2,3,6,7-tetrahydrothieno[2,3-c]pyridine (PubChem CID 166842058) has the molecular formula C7H8INS and a molecular weight of 265.12 g/mol. Its IUPAC name is 2-iodo-2,3,6,7-tetrahydrothieno[2,3-c]pyridine.
| Compound Name | 2-iodo-2,3,6,7-tetrahydrothieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 166842058 |
| Molecular Formula | C7H8INS |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 264.94 |
| IUPAC Name | 2-iodo-2,3,6,7-tetrahydrothieno[2,3-c]pyridine |
| SMILES | IC1CC2=C(CNC=C2)S1 |
| InChI | InChI=1S/C7H8INS/c8-7-3-5-1-2-9-4-6(5)10-7/h1-2,7,9H,3-4H2 |
| InChIKey | HJQHEVYMUATQHT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|