C17H22N2O4 — CID 166842177
2-methoxyethyl (2S)-4-methyl-2-(4-oxoquinazolin-3-yl)pentanoate (PubChem CID 166842177) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-methoxyethyl (2S)-4-methyl-2-(4-oxoquinazolin-3-yl)pentanoate.
| Compound Name | 2-methoxyethyl (2S)-4-methyl-2-(4-oxoquinazolin-3-yl)pentanoate |
|---|---|
| PubChem CID | 166842177 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-methoxyethyl (2S)-4-methyl-2-(4-oxoquinazolin-3-yl)pentanoate |
| SMILES | COCCOC(=O)[C@H](CC(C)C)n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C17H22N2O4/c1-12(2)10-15(17(21)23-9-8-22-3)19-11-18-14-7-5-4-6-13(14)16(19)20/h4-7,11-12,15H,8-10H2,1-3H3/t15-/m0/s1 |
| InChIKey | KFGLGLOTGKKOBF-HNNXBMFYSA-N |
| XLogP | 2.17 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|