C15H11ClN2 — CID 166842378
5-(4-chlorophenyl)-3-ethenyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 166842378) has the molecular formula C15H11ClN2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-ethenyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(4-chlorophenyl)-3-ethenyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 166842378 |
| Molecular Formula | C15H11ClN2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5-(4-chlorophenyl)-3-ethenyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=Cc1c[nH]c2ncc(-c3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C15H11ClN2/c1-2-10-8-17-15-14(10)7-12(9-18-15)11-3-5-13(16)6-4-11/h2-9H,1H2,(H,17,18) |
| InChIKey | LCHAQQDOIDHXIH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |