C23H23F3N6O2 — CID 166843253
5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-[2-[[(4R)-4-methyl-1,3-oxazolidin-2-ylidene]amino]ethoxy]pyrimidin-2-amine (PubChem CID 166843253) has the molecular formula C23H23F3N6O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is 5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-[2-[[(4R)-4-methyl-1,3-oxazolidin-2-ylidene]amino]ethoxy]pyrimidin-2-amine.
| Compound Name | 5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-[2-[[(4R)-4-methyl-1,3-oxazolidin-2-ylidene]amino]ethoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166843253 |
| Molecular Formula | C23H23F3N6O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-4-(4-fluorophenyl)-6-[2-[[(4R)-4-methyl-1,3-oxazolidin-2-ylidene]amino]ethoxy]pyrimidin-2-amine |
| SMILES | Cc1cc(-c2c(OCC/N=C3\N[C@H](C)CO3)nc(N)nc2-c2ccc(F)cc2)cc(C(F)F)n1 |
| InChI | InChI=1S/C23H23F3N6O2/c1-12-9-15(10-17(29-12)20(25)26)18-19(14-3-5-16(24)6-4-14)31-22(27)32-21(18)33-8-7-28-23-30-13(2)11-34-23/h3-6,9-10,13,20H,7-8,11H2,1-2H3,(H,28,30)(H2,27,31,32)/t13-/m1/s1 |
| InChIKey | BPPYPJYECQOBGL-CYBMUJFWSA-N |
| XLogP | 3.92 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|