C20H18F3N5O3 — CID 175094135
2-[2-amino-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-6-(4-fluorophenyl)pyrimidin-4-yl]oxyethyl carbamate (PubChem CID 175094135) has the molecular formula C20H18F3N5O3 and a molecular weight of 433.39 g/mol. Its IUPAC name is 2-[2-amino-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-6-(4-fluorophenyl)pyrimidin-4-yl]oxyethyl carbamate.
| Compound Name | 2-[2-amino-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-6-(4-fluorophenyl)pyrimidin-4-yl]oxyethyl carbamate |
|---|---|
| PubChem CID | 175094135 |
| Molecular Formula | C20H18F3N5O3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[2-amino-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-6-(4-fluorophenyl)pyrimidin-4-yl]oxyethyl carbamate |
| SMILES | Cc1cc(-c2c(OCCOC(N)=O)nc(N)nc2-c2ccc(F)cc2)cc(C(F)F)n1 |
| InChI | InChI=1S/C20H18F3N5O3/c1-10-8-12(9-14(26-10)17(22)23)15-16(11-2-4-13(21)5-3-11)27-19(24)28-18(15)30-6-7-31-20(25)29/h2-5,8-9,17H,6-7H2,1H3,(H2,25,29)(H2,24,27,28) |
| InChIKey | WVAXPCNCJWQGKK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|