C21H32N4O6S — CID 166843346
tert-butyl N-[2-[[5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonyl-2-pyridinyl]oxymethyl]prop-2-enyl]carbamate (PubChem CID 166843346) has the molecular formula C21H32N4O6S and a molecular weight of 468.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonyl-2-pyridinyl]oxymethyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonyl-2-pyridinyl]oxymethyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 166843346 |
| Molecular Formula | C21H32N4O6S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | tert-butyl N-[2-[[5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonyl-2-pyridinyl]oxymethyl]prop-2-enyl]carbamate |
| SMILES | C=C(CNC(=O)OC(C)(C)C)COc1ccc(S(=O)(=O)N2CCC(C(=O)NC)CC2)cn1 |
| InChI | InChI=1S/C21H32N4O6S/c1-15(12-24-20(27)31-21(2,3)4)14-30-18-7-6-17(13-23-18)32(28,29)25-10-8-16(9-11-25)19(26)22-5/h6-7,13,16H,1,8-12,14H2,2-5H3,(H,22,26)(H,24,27) |
| InChIKey | UXLRIZYYLOXNEH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|