C25H32ClN7O2 — CID 166848766
4-[(1R,6S,7S)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-7-methyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydropteridin-7-one (PubChem CID 166848766) has the molecular formula C25H32ClN7O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 4-[(1R,6S,7S)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-7-methyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydropteridin-7-one.
| Compound Name | 4-[(1R,6S,7S)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-7-methyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydropteridin-7-one |
|---|---|
| PubChem CID | 166848766 |
| Molecular Formula | C25H32ClN7O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 4-[(1R,6S,7S)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-7-methyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydropteridin-7-one |
| SMILES | CC(C)NC[C@@H](C(=O)N1CCN(c2ncnc3c2N(C)CC(=O)N3)[C@@H]2[C@H](C)[C@@H]21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H32ClN7O2/c1-14(2)27-11-18(16-5-7-17(26)8-6-16)25(35)33-10-9-32(20-15(3)21(20)33)24-22-23(28-13-29-24)30-19(34)12-31(22)4/h5-8,13-15,18,20-21,27H,9-12H2,1-4H3,(H,28,29,30,34)/t15-,18+,20+,21-/m0/s1 |
| InChIKey | SSXGFZLIBQGAGE-SKRQURTPSA-N |
| XLogP | 2.34 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |