C9H12F2 — CID 166850843
4,5-difluoro-1-propan-2-ylcyclohexa-1,3-diene (PubChem CID 166850843) has the molecular formula C9H12F2 and a molecular weight of 158.19 g/mol. Its IUPAC name is 4,5-difluoro-1-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | 4,5-difluoro-1-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 166850843 |
| Molecular Formula | C9H12F2 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 4,5-difluoro-1-propan-2-ylcyclohexa-1,3-diene |
| SMILES | CC(C)C1=CC=C(F)C(F)C1 |
| InChI | InChI=1S/C9H12F2/c1-6(2)7-3-4-8(10)9(11)5-7/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | OGCZBTMAARFHCA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |