C15H25N3O5 — CID 166854630
tert-butyl 3-[2-[[(Z)-but-2-enoyl]-formylamino]ethylcarbamoylamino]propanoate (PubChem CID 166854630) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is tert-butyl 3-[2-[[(Z)-but-2-enoyl]-formylamino]ethylcarbamoylamino]propanoate.
| Compound Name | tert-butyl 3-[2-[[(Z)-but-2-enoyl]-formylamino]ethylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 166854630 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | tert-butyl 3-[2-[[(Z)-but-2-enoyl]-formylamino]ethylcarbamoylamino]propanoate |
| SMILES | C/C=C\C(=O)N(C=O)CCNC(=O)NCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O5/c1-5-6-12(20)18(11-19)10-9-17-14(22)16-8-7-13(21)23-15(2,3)4/h5-6,11H,7-10H2,1-4H3,(H2,16,17,22)/b6-5- |
| InChIKey | ZXPHEBCKNZTCSM-WAYWQWQTSA-N |
| XLogP | 0.58 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|