C24H42N4O5S — CID 144842603
6-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]-N-[6-(3-methylsulfanylpropanoylamino)hexyl]hexanamide (PubChem CID 144842603) has the molecular formula C24H42N4O5S and a molecular weight of 498.69 g/mol. Its IUPAC name is 6-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]-N-[6-(3-methylsulfanylpropanoylamino)hexyl]hexanamide.
| Compound Name | 6-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]-N-[6-(3-methylsulfanylpropanoylamino)hexyl]hexanamide |
|---|---|
| PubChem CID | 144842603 |
| Molecular Formula | C24H42N4O5S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 6-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]-N-[6-(3-methylsulfanylpropanoylamino)hexyl]hexanamide |
| SMILES | C/C=C\C(=O)N(C=O)CCC(=O)NCCCCCC(=O)NCCCCCCNC(=O)CCSC |
| InChI | InChI=1S/C24H42N4O5S/c1-3-11-24(33)28(20-29)18-13-22(31)26-17-10-6-7-12-21(30)25-15-8-4-5-9-16-27-23(32)14-19-34-2/h3,11,20H,4-10,12-19H2,1-2H3,(H,25,30)(H,26,31)(H,27,32)/b11-3- |
| InChIKey | GZBOOPYIAKOXDQ-JYOAFUTRSA-N |
| XLogP | 2.16 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|