C17H28N2O8 — CID 167261936
2-[2-[2-[2-[4-[[(Z)-but-2-enoyl]-formylamino]butanoylamino]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 167261936) has the molecular formula C17H28N2O8 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[[(Z)-but-2-enoyl]-formylamino]butanoylamino]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[4-[[(Z)-but-2-enoyl]-formylamino]butanoylamino]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 167261936 |
| Molecular Formula | C17H28N2O8 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[2-[2-[2-[4-[[(Z)-but-2-enoyl]-formylamino]butanoylamino]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | C/C=C\C(=O)N(C=O)CCCC(=O)NCCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C17H28N2O8/c1-2-4-16(22)19(14-20)7-3-5-15(21)18-6-8-25-9-10-26-11-12-27-13-17(23)24/h2,4,14H,3,5-13H2,1H3,(H,18,21)(H,23,24)/b4-2- |
| InChIKey | CXBDRVMFEOGXLH-RQOWECAXSA-N |
| XLogP | -0.42 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|