C8H14ClNO5 — CID 163273323
2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]acetic acid (PubChem CID 163273323) has the molecular formula C8H14ClNO5 and a molecular weight of 239.65 g/mol. Its IUPAC name is 2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 163273323 |
| Molecular Formula | C8H14ClNO5 |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCNC(=O)CCl |
| InChI | InChI=1S/C8H14ClNO5/c9-5-7(11)10-1-2-14-3-4-15-6-8(12)13/h1-6H2,(H,10,11)(H,12,13) |
| InChIKey | AUAQGTJILHWRJW-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|