C22H39N3O13 — CID 176706962
2-[2-[2-[2-[[5-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethylamino]-3-formamido-5-oxopentanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 176706962) has the molecular formula C22H39N3O13 and a molecular weight of 553.56 g/mol. Its IUPAC name is 2-[2-[2-[2-[[5-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethylamino]-3-formamido-5-oxopentanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[[5-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethylamino]-3-formamido-5-oxopentanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 176706962 |
| Molecular Formula | C22H39N3O13 |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 2-[2-[2-[2-[[5-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethylamino]-3-formamido-5-oxopentanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=CNC(CC(=O)NCCOCCOCCOCC(=O)O)CC(=O)NCCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C22H39N3O13/c26-17-25-18(13-19(27)23-1-3-33-5-7-35-9-11-37-15-21(29)30)14-20(28)24-2-4-34-6-8-36-10-12-38-16-22(31)32/h17-18H,1-16H2,(H,23,27)(H,24,28)(H,25,26)(H,29,30)(H,31,32) |
| InChIKey | SAHLBAJLQFHCSP-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 217.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|