C18H16N2O2 — CID 166854940
2-[4-(6-oxo-2,3-dihydropyridin-1-yl)phenyl]benzamide (PubChem CID 166854940) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[4-(6-oxo-2,3-dihydropyridin-1-yl)phenyl]benzamide.
| Compound Name | 2-[4-(6-oxo-2,3-dihydropyridin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 166854940 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[4-(6-oxo-2,3-dihydropyridin-1-yl)phenyl]benzamide |
| SMILES | NC(=O)c1ccccc1-c1ccc(N2CCC=CC2=O)cc1 |
| InChI | InChI=1S/C18H16N2O2/c19-18(22)16-6-2-1-5-15(16)13-8-10-14(11-9-13)20-12-4-3-7-17(20)21/h1-3,5-11H,4,12H2,(H2,19,22) |
| InChIKey | ODEZTXSWTNMPFF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |