C27H28BrClN2O3 — CID 166854985
N-[2-[[4-[(2-bromo-3-cyclohexa-1,5-dien-1-ylphenyl)methoxy]-5-chloro-2-prop-2-ynoxyphenyl]methylamino]ethyl]acetamide (PubChem CID 166854985) has the molecular formula C27H28BrClN2O3 and a molecular weight of 543.89 g/mol. Its IUPAC name is N-[2-[[4-[(2-bromo-3-cyclohexa-1,5-dien-1-ylphenyl)methoxy]-5-chloro-2-prop-2-ynoxyphenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-[(2-bromo-3-cyclohexa-1,5-dien-1-ylphenyl)methoxy]-5-chloro-2-prop-2-ynoxyphenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 166854985 |
| Molecular Formula | C27H28BrClN2O3 |
| Molecular Weight | 543.89 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | N-[2-[[4-[(2-bromo-3-cyclohexa-1,5-dien-1-ylphenyl)methoxy]-5-chloro-2-prop-2-ynoxyphenyl]methylamino]ethyl]acetamide |
| SMILES | C#CCOc1cc(OCc2cccc(C3=CCCC=C3)c2Br)c(Cl)cc1CNCCNC(C)=O |
| InChI | InChI=1S/C27H28BrClN2O3/c1-3-14-33-25-16-26(24(29)15-22(25)17-30-12-13-31-19(2)32)34-18-21-10-7-11-23(27(21)28)20-8-5-4-6-9-20/h1,5,7-11,15-16,30H,4,6,12-14,17-18H2,2H3,(H,31,32) |
| InChIKey | ZUOYHLCZWKWDLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|