C15H22N6O2 — CID 166857102
4-(4-hydroxyazepan-1-yl)-2-(morpholin-4-ylamino)pyrimidine-5-carbonitrile (PubChem CID 166857102) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-(4-hydroxyazepan-1-yl)-2-(morpholin-4-ylamino)pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-hydroxyazepan-1-yl)-2-(morpholin-4-ylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 166857102 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-(4-hydroxyazepan-1-yl)-2-(morpholin-4-ylamino)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(NN2CCOCC2)nc1N1CCCC(O)CC1 |
| InChI | InChI=1S/C15H22N6O2/c16-10-12-11-17-15(19-21-6-8-23-9-7-21)18-14(12)20-4-1-2-13(22)3-5-20/h11,13,22H,1-9H2,(H,17,18,19) |
| InChIKey | WRZORTQYAGDVSX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |