C26H29N7O3 — CID 168826977
N-[2-[(1S,3R)-3-[(5-cyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide (PubChem CID 168826977) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[2-[(1S,3R)-3-[(5-cyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide.
| Compound Name | N-[2-[(1S,3R)-3-[(5-cyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 168826977 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-[2-[(1S,3R)-3-[(5-cyano-4-morpholin-4-ylpyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)C(=O)N([C@H]1CCC[C@@H](Nc3ncc(C#N)c(N4CCOCC4)n3)C1)C2 |
| InChI | InChI=1S/C26H29N7O3/c1-2-23(34)29-20-7-6-17-16-33(25(35)22(17)13-20)21-5-3-4-19(12-21)30-26-28-15-18(14-27)24(31-26)32-8-10-36-11-9-32/h2,6-7,13,15,19,21H,1,3-5,8-12,16H2,(H,29,34)(H,28,30,31)/t19-,21+/m1/s1 |
| InChIKey | NGGOFXMXBSKDAU-CTNGQTDRSA-N |
| XLogP | 2.69 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|