C28H29N5O3 — CID 168827302
N-[2-[(1S,3R)-3-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide (PubChem CID 168827302) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[2-[(1S,3R)-3-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide.
| Compound Name | N-[2-[(1S,3R)-3-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 168827302 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-[2-[(1S,3R)-3-[[5-(4-methoxyphenyl)pyrimidin-2-yl]amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)C(=O)N([C@H]1CCC[C@@H](Nc3ncc(-c4ccc(OC)cc4)cn3)C1)C2 |
| InChI | InChI=1S/C28H29N5O3/c1-3-26(34)31-22-10-7-19-17-33(27(35)25(19)14-22)23-6-4-5-21(13-23)32-28-29-15-20(16-30-28)18-8-11-24(36-2)12-9-18/h3,7-12,14-16,21,23H,1,4-6,13,17H2,2H3,(H,31,34)(H,29,30,32)/t21-,23+/m1/s1 |
| InChIKey | MGCCURLAZQLQCN-GGAORHGYSA-N |
| XLogP | 4.66 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|