C24H26N6O3 — CID 168827232
N-[2-[(1S,3R)-3-[(5-cyano-4-methoxypyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]-N-methylprop-2-enamide (PubChem CID 168827232) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[2-[(1S,3R)-3-[(5-cyano-4-methoxypyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[(1S,3R)-3-[(5-cyano-4-methoxypyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 168827232 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[2-[(1S,3R)-3-[(5-cyano-4-methoxypyrimidin-2-yl)amino]cyclohexyl]-3-oxo-1H-isoindol-5-yl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc2c(c1)C(=O)N([C@H]1CCC[C@@H](Nc3ncc(C#N)c(OC)n3)C1)C2 |
| InChI | InChI=1S/C24H26N6O3/c1-4-21(31)29(2)18-9-8-15-14-30(23(32)20(15)11-18)19-7-5-6-17(10-19)27-24-26-13-16(12-25)22(28-24)33-3/h4,8-9,11,13,17,19H,1,5-7,10,14H2,2-3H3,(H,26,27,28)/t17-,19+/m1/s1 |
| InChIKey | FANGTNZJZAXUKE-MJGOQNOKSA-N |
| XLogP | 2.88 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|