C20H21N7O3 — CID 168827257
4-methoxy-2-[[(1R,3S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)cyclohexyl]amino]pyrimidine-5-carbonitrile (PubChem CID 168827257) has the molecular formula C20H21N7O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-methoxy-2-[[(1R,3S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)cyclohexyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-methoxy-2-[[(1R,3S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)cyclohexyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168827257 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-methoxy-2-[[(1R,3S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)cyclohexyl]amino]pyrimidine-5-carbonitrile |
| SMILES | COc1nc(N[C@@H]2CCC[C@H](c3nc4cc([N+](=O)[O-])ccc4n3C)C2)ncc1C#N |
| InChI | InChI=1S/C20H21N7O3/c1-26-17-7-6-15(27(28)29)9-16(17)24-18(26)12-4-3-5-14(8-12)23-20-22-11-13(10-21)19(25-20)30-2/h6-7,9,11-12,14H,3-5,8H2,1-2H3,(H,22,23,25)/t12-,14+/m0/s1 |
| InChIKey | WYXNSWVZZYNKMY-GXTWGEPZSA-N |
| XLogP | 3.29 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|