C17H26N2 — CID 166857934
N-(6-buta-1,3-dien-2-ylcyclohexa-1,3-dien-1-yl)-N,1-dimethylpiperidin-4-amine (PubChem CID 166857934) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-(6-buta-1,3-dien-2-ylcyclohexa-1,3-dien-1-yl)-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-(6-buta-1,3-dien-2-ylcyclohexa-1,3-dien-1-yl)-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 166857934 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-(6-buta-1,3-dien-2-ylcyclohexa-1,3-dien-1-yl)-N,1-dimethylpiperidin-4-amine |
| SMILES | C=CC(=C)C1CC=CC=C1N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C17H26N2/c1-5-14(2)16-8-6-7-9-17(16)19(4)15-10-12-18(3)13-11-15/h5-7,9,15-16H,1-2,8,10-13H2,3-4H3 |
| InChIKey | ZJWYIHQQXOGTJA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|