C25H41FN2 — CID 156796983
4-ethenyl-4-fluoro-1-[[1-[(2E,4Z)-5-methyl-3-(2-methylpropyl)hepta-2,4,6-trien-2-yl]piperidin-4-yl]methyl]piperidine (PubChem CID 156796983) has the molecular formula C25H41FN2 and a molecular weight of 388.62 g/mol. Its IUPAC name is 4-ethenyl-4-fluoro-1-[[1-[(2E,4Z)-5-methyl-3-(2-methylpropyl)hepta-2,4,6-trien-2-yl]piperidin-4-yl]methyl]piperidine.
| Compound Name | 4-ethenyl-4-fluoro-1-[[1-[(2E,4Z)-5-methyl-3-(2-methylpropyl)hepta-2,4,6-trien-2-yl]piperidin-4-yl]methyl]piperidine |
|---|---|
| PubChem CID | 156796983 |
| Molecular Formula | C25H41FN2 |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 4-ethenyl-4-fluoro-1-[[1-[(2E,4Z)-5-methyl-3-(2-methylpropyl)hepta-2,4,6-trien-2-yl]piperidin-4-yl]methyl]piperidine |
| SMILES | C=C/C(C)=C\C(CC(C)C)=C(/C)N1CCC(CN2CCC(F)(C=C)CC2)CC1 |
| InChI | InChI=1S/C25H41FN2/c1-7-21(5)18-24(17-20(3)4)22(6)28-13-9-23(10-14-28)19-27-15-11-25(26,8-2)12-16-27/h7-8,18,20,23H,1-2,9-17,19H2,3-6H3/b21-18-,24-22+ |
| InChIKey | XTADPYKZJXZYPB-SJSCYNRQSA-N |
| XLogP | 6.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|