C24H42F2N2 — CID 176922351
4,4-difluoro-1-[2-[4-[(5Z)-3,6,7-trimethylnona-3,5-dien-4-yl]piperidin-1-yl]ethyl]piperidine (PubChem CID 176922351) has the molecular formula C24H42F2N2 and a molecular weight of 396.61 g/mol. Its IUPAC name is 4,4-difluoro-1-[2-[4-[(5Z)-3,6,7-trimethylnona-3,5-dien-4-yl]piperidin-1-yl]ethyl]piperidine.
| Compound Name | 4,4-difluoro-1-[2-[4-[(5Z)-3,6,7-trimethylnona-3,5-dien-4-yl]piperidin-1-yl]ethyl]piperidine |
|---|---|
| PubChem CID | 176922351 |
| Molecular Formula | C24H42F2N2 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.33 |
| IUPAC Name | 4,4-difluoro-1-[2-[4-[(5Z)-3,6,7-trimethylnona-3,5-dien-4-yl]piperidin-1-yl]ethyl]piperidine |
| SMILES | CCC(C)=C(/C=C(/C)C(C)CC)C1CCN(CCN2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C24H42F2N2/c1-6-19(3)21(5)18-23(20(4)7-2)22-8-12-27(13-9-22)16-17-28-14-10-24(25,26)11-15-28/h18-19,22H,6-17H2,1-5H3/b21-18-,23-20? |
| InChIKey | QZDRKKZCBZGKSH-RTFHNISQSA-N |
| XLogP | 6.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|