C23H32F6N2 — CID 143980345
1-[(1E,3E)-4-piperidin-1-yl-1-[(E)-4,4,4-trifluorobut-2-enyl]-3-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-1,3-dienyl]piperidine (PubChem CID 143980345) has the molecular formula C23H32F6N2 and a molecular weight of 450.51 g/mol. Its IUPAC name is 1-[(1E,3E)-4-piperidin-1-yl-1-[(E)-4,4,4-trifluorobut-2-enyl]-3-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-1,3-dienyl]piperidine.
| Compound Name | 1-[(1E,3E)-4-piperidin-1-yl-1-[(E)-4,4,4-trifluorobut-2-enyl]-3-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 143980345 |
| Molecular Formula | C23H32F6N2 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-[(1E,3E)-4-piperidin-1-yl-1-[(E)-4,4,4-trifluorobut-2-enyl]-3-[(E)-3,3,3-trifluoroprop-1-enyl]hexa-1,3-dienyl]piperidine |
| SMILES | CC/C(=C(/C=C/C(F)(F)F)\C=C(/C/C=C/C(F)(F)F)N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C23H32F6N2/c1-2-21(31-16-7-4-8-17-31)19(11-13-23(27,28)29)18-20(10-9-12-22(24,25)26)30-14-5-3-6-15-30/h9,11-13,18H,2-8,10,14-17H2,1H3/b12-9+,13-11+,20-18+,21-19+ |
| InChIKey | FBYFUOVWLBQRMZ-YUPKRBPNSA-N |
| XLogP | 7.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|