C6H12N4O — CID 166858592
4-(methoxymethyl)-N,N-dimethyltriazol-1-amine (PubChem CID 166858592) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is 4-(methoxymethyl)-N,N-dimethyltriazol-1-amine.
| Compound Name | 4-(methoxymethyl)-N,N-dimethyltriazol-1-amine |
|---|---|
| PubChem CID | 166858592 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 4-(methoxymethyl)-N,N-dimethyltriazol-1-amine |
| SMILES | COCc1cn(N(C)C)nn1 |
| InChI | InChI=1S/C6H12N4O/c1-9(2)10-4-6(5-11-3)7-8-10/h4H,5H2,1-3H3 |
| InChIKey | KUZKHCNHVHIPKL-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |