C24H26F2N10O2 — CID 166859404
3-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-1-ethanimidoyl-1-ethylurea (PubChem CID 166859404) has the molecular formula C24H26F2N10O2 and a molecular weight of 524.54 g/mol. Its IUPAC name is 3-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-1-ethanimidoyl-1-ethylurea.
| Compound Name | 3-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-1-ethanimidoyl-1-ethylurea |
|---|---|
| PubChem CID | 166859404 |
| Molecular Formula | C24H26F2N10O2 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 3-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-1-ethanimidoyl-1-ethylurea |
| SMILES | [H]/N=C(\C)N(CC)C(=O)Nc1nc(N2CCN(C(=O)N3N=CC[C@H]3c3cc(F)cc(C#N)c3)CC2)ncc1F |
| InChI | InChI=1S/C24H26F2N10O2/c1-3-35(15(2)28)23(37)32-21-19(26)14-29-22(31-21)33-6-8-34(9-7-33)24(38)36-20(4-5-30-36)17-10-16(13-27)11-18(25)12-17/h5,10-12,14,20,28H,3-4,6-9H2,1-2H3,(H,29,31,32,37)/b28-15+/t20-/m0/s1 |
| InChIKey | YIKSMFFBYDNKRL-LDWYRGJHSA-N |
| XLogP | 3.15 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|