C21H21F2N11O — CID 168824081
N'-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-N-hydrazinylideneethanimidamide (PubChem CID 168824081) has the molecular formula C21H21F2N11O and a molecular weight of 481.47 g/mol. Its IUPAC name is N'-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-N-hydrazinylideneethanimidamide.
| Compound Name | N'-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-N-hydrazinylideneethanimidamide |
|---|---|
| PubChem CID | 168824081 |
| Molecular Formula | C21H21F2N11O |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N'-[2-[4-[(3S)-3-(3-cyano-5-fluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperazin-1-yl]-5-fluoropyrimidin-4-yl]-N-hydrazinylideneethanimidamide |
| SMILES | CC(/N=N/N)=N\c1nc(N2CCN(C(=O)N3N=CC[C@H]3c3cc(F)cc(C#N)c3)CC2)ncc1F |
| InChI | InChI=1S/C21H21F2N11O/c1-13(30-31-25)28-19-17(23)12-26-20(29-19)32-4-6-33(7-5-32)21(35)34-18(2-3-27-34)15-8-14(11-24)9-16(22)10-15/h3,8-10,12,18H,2,4-7H2,1H3,(H2,25,26,28,29,30)/t18-/m0/s1 |
| InChIKey | CMBIITYKSKZUAU-SFHVURJKSA-N |
| XLogP | 2.68 |
| TPSA | 151.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|