C10H19NS — CID 166860240
(3Z)-5-methyl-3-propan-2-ylsulfanylhexa-1,3-dien-2-amine (PubChem CID 166860240) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (3Z)-5-methyl-3-propan-2-ylsulfanylhexa-1,3-dien-2-amine.
| Compound Name | (3Z)-5-methyl-3-propan-2-ylsulfanylhexa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 166860240 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (3Z)-5-methyl-3-propan-2-ylsulfanylhexa-1,3-dien-2-amine |
| SMILES | C=C(N)/C(=C/C(C)C)SC(C)C |
| InChI | InChI=1S/C10H19NS/c1-7(2)6-10(9(5)11)12-8(3)4/h6-8H,5,11H2,1-4H3/b10-6- |
| InChIKey | UCJRBWAOTPYSHN-POHAHGRESA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|