C25H35N7O2 — CID 166863244
2-N-[4-(5-amino-3-morpholin-4-ylpentyl)-2-methoxyphenyl]-4-N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 166863244) has the molecular formula C25H35N7O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-N-[4-(5-amino-3-morpholin-4-ylpentyl)-2-methoxyphenyl]-4-N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(5-amino-3-morpholin-4-ylpentyl)-2-methoxyphenyl]-4-N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166863244 |
| Molecular Formula | C25H35N7O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 2-N-[4-(5-amino-3-morpholin-4-ylpentyl)-2-methoxyphenyl]-4-N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | C=CCNc1nc(Nc2ccc(CCC(CCN)N3CCOCC3)cc2OC)nc2[nH]ccc12 |
| InChI | InChI=1S/C25H35N7O2/c1-3-11-27-23-20-9-12-28-24(20)31-25(30-23)29-21-7-5-18(17-22(21)33-2)4-6-19(8-10-26)32-13-15-34-16-14-32/h3,5,7,9,12,17,19H,1,4,6,8,10-11,13-16,26H2,2H3,(H3,27,28,29,30,31) |
| InChIKey | HKNYJGHLYIBPOF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|