About [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate
[butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate (PubChem CID 16686392) has the molecular formula C28H35N2O4Sb
and a molecular weight of 585.36 g/mol. Its IUPAC name is [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate.
Molecular Properties
| Compound Name | [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate |
| PubChem CID | 16686392 |
| Molecular Formula | C28H35N2O4Sb |
| Molecular Weight | 585.36 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)O[Sb](OC(=O)NCCCC)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.2C5H11NO2.Sb/c3*1-2-4-6-5-3-1;2*1-2-3-4-6-5(7)8;/h3*1-5H;2*6H,2-4H2,1H3,(H,7,8);/q;;;;;+2/p-2 |
| InChIKey | FUQJWBRODZBJLZ-UHFFFAOYSA-L |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate?
The IUPAC name of [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate (CID 16686392) is [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate.
What is the SMILES notation for [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate?
The canonical SMILES for [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate is CCCCNC(=O)O[Sb](OC(=O)NCCCC)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate?
The InChIKey is FUQJWBRODZBJLZ-UHFFFAOYSA-L. The full InChI is InChI=1S/3C6H5.2C5H11NO2.Sb/c3*1-2-4-6-5-3-1;2*1-2-3-4-6-5(7)8;/h3*1-5H;2*6H,2-4H2,1H3,(H,7,8);/q;;;;;+2/p-2.
What are the key properties of [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate?
[butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate has a molecular weight of 585.36 g/mol, XLogP of 4.16, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [butylcarbamoyloxy(triphenyl)-λ5-stibanyl] N-butylcarbamate is sourced from PubChem (CID 16686392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).