C25H29BrNO2P — CID 158747681
6-(carboxyamino)hexyl-triphenylphosphanium bromide (PubChem CID 158747681) has the molecular formula C25H29BrNO2P and a molecular weight of 486.39 g/mol. Its IUPAC name is 6-(carboxyamino)hexyl-triphenylphosphanium bromide.
| Compound Name | 6-(carboxyamino)hexyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 158747681 |
| Molecular Formula | C25H29BrNO2P |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 6-(carboxyamino)hexyl-triphenylphosphanium bromide |
| SMILES | O=C(O)NCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C25H28NO2P.BrH/c27-25(28)26-20-12-1-2-13-21-29(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24;/h3-11,14-19,26H,1-2,12-13,20-21H2;1H |
| InChIKey | INBSPPQRFSNBMJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|