C19H22NOP — CID 139171272
N-cyclohexyl-1-diphenylphosphanylformamide (PubChem CID 139171272) has the molecular formula C19H22NOP and a molecular weight of 311.37 g/mol. Its IUPAC name is N-cyclohexyl-1-diphenylphosphanylformamide.
| Compound Name | N-cyclohexyl-1-diphenylphosphanylformamide |
|---|---|
| PubChem CID | 139171272 |
| Molecular Formula | C19H22NOP |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-cyclohexyl-1-diphenylphosphanylformamide |
| SMILES | O=C(NC1CCCCC1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22NOP/c21-19(20-16-10-4-1-5-11-16)22(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h2-3,6-9,12-16H,1,4-5,10-11H2,(H,20,21) |
| InChIKey | NZZVTZUHYBUKLH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|