About dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane
dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane (PubChem CID 134880019) has the molecular formula C19H32NOPS
and a molecular weight of 353.51 g/mol. Its IUPAC name is dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 134880019 |
| Molecular Formula | C19H32NOPS |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.CP([O-])(=S)c1ccccc1 |
| InChI | InChI=1S/C12H23N.C7H9OPS/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-9(8,10)7-5-3-2-4-6-7/h11-13H,1-10H2;2-6H,1H3,(H,8,10) |
| InChIKey | WANNCGYCGSLVFV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane?
The IUPAC name of dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane (CID 134880019) is dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane is C1CCC([NH2+]C2CCCCC2)CC1.CP([O-])(=S)c1ccccc1.
What is the InChIKey of dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane?
The InChIKey is WANNCGYCGSLVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C7H9OPS/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-9(8,10)7-5-3-2-4-6-7/h11-13H,1-10H2;2-6H,1H3,(H,8,10).
What are the key properties of dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane?
dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane has a molecular weight of 353.51 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylazanium;methyl-oxido-phenyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 134880019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).